C25H36N6O3S — CID 142788696
1-[3-(4-butylpiperazine-1-carboximidoyl)phenyl]-3-(2-propyl-4-sulfamoylphenyl)urea (PubChem CID 142788696) has the molecular formula C25H36N6O3S and a molecular weight of 500.67 g/mol. Its IUPAC name is 1-[3-(4-butylpiperazine-1-carboximidoyl)phenyl]-3-(2-propyl-4-sulfamoylphenyl)urea.
| Compound Name | 1-[3-(4-butylpiperazine-1-carboximidoyl)phenyl]-3-(2-propyl-4-sulfamoylphenyl)urea |
|---|---|
| PubChem CID | 142788696 |
| Molecular Formula | C25H36N6O3S |
| Molecular Weight | 500.67 g/mol |
| Exact Mass | 500.26 |
| IUPAC Name | 1-[3-(4-butylpiperazine-1-carboximidoyl)phenyl]-3-(2-propyl-4-sulfamoylphenyl)urea |
| SMILES | [H]/N=C(/c1cccc(NC(=O)Nc2ccc(S(N)(=O)=O)cc2CCC)c1)N1CCN(CCCC)CC1 |
| InChI | InChI=1S/C25H36N6O3S/c1-3-5-12-30-13-15-31(16-14-30)24(26)20-8-6-9-21(17-20)28-25(32)29-23-11-10-22(35(27,33)34)18-19(23)7-4-2/h6,8-11,17-18,26H,3-5,7,12-16H2,1-2H3,(H2,27,33,34)(H2,28,29,32)/b26-24- |
| InChIKey | FRSQUGBWUPOQJO-LCUIJRPUSA-N |
| XLogP | 3.67 |
| TPSA | 131.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.67 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|