C23H32N6O3S — CID 46851984
1-[3-(4-butylpiperazine-1-carboximidoyl)phenyl]-3-[4-(methylsulfamoyl)phenyl]urea (PubChem CID 46851984) has the molecular formula C23H32N6O3S and a molecular weight of 472.62 g/mol. Its IUPAC name is 1-[3-(4-butylpiperazine-1-carboximidoyl)phenyl]-3-[4-(methylsulfamoyl)phenyl]urea.
| Compound Name | 1-[3-(4-butylpiperazine-1-carboximidoyl)phenyl]-3-[4-(methylsulfamoyl)phenyl]urea |
|---|---|
| PubChem CID | 46851984 |
| Molecular Formula | C23H32N6O3S |
| Molecular Weight | 472.62 g/mol |
| Exact Mass | 472.23 |
| IUPAC Name | 1-[3-(4-butylpiperazine-1-carboximidoyl)phenyl]-3-[4-(methylsulfamoyl)phenyl]urea |
| SMILES | [H]/N=C(/c1cccc(NC(=O)Nc2ccc(S(=O)(=O)NC)cc2)c1)N1CCN(CCCC)CC1 |
| InChI | InChI=1S/C23H32N6O3S/c1-3-4-12-28-13-15-29(16-14-28)22(24)18-6-5-7-20(17-18)27-23(30)26-19-8-10-21(11-9-19)33(31,32)25-2/h5-11,17,24-25H,3-4,12-16H2,1-2H3,(H2,26,27,30)/b24-22- |
| InChIKey | ASUYGKGBWUKVQE-GYHWCHFESA-N |
| XLogP | 2.98 |
| TPSA | 117.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.62 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|