1-oxa-3,9-diazaspiro[4.5]decane-9-carboxylic acid

C8H14N2O3 — CID 142790989

IUPAC1-oxa-3,9-diazaspiro[4.5]decane-9-carboxylic acid
SMILESO=C(O)N1CCCC2(CNCO2)C1
InChIInChI=1S/C8H14N2O3/c11-7(12)10-3-1-2-8(5-10)4-9-6-13-8/h9H,1-6H2,(H,11,12)
InChIKeyZFYMOZCFCGLLES-UHFFFAOYSA-N
MW186.21 g/mol
LogP0.08
Rot. Bonds

About 1-oxa-3,9-diazaspiro[4.5]decane-9-carboxylic acid

1-oxa-3,9-diazaspiro[4.5]decane-9-carboxylic acid (PubChem CID 142790989) has the molecular formula C8H14N2O3 and a molecular weight of 186.21 g/mol. Its IUPAC name is 1-oxa-3,9-diazaspiro[4.5]decane-9-carboxylic acid.

Molecular Properties

Compound Name1-oxa-3,9-diazaspiro[4.5]decane-9-carboxylic acid
PubChem CID142790989
Molecular FormulaC8H14N2O3
Molecular Weight186.21 g/mol
Exact Mass186.10
IUPAC Name1-oxa-3,9-diazaspiro[4.5]decane-9-carboxylic acid
SMILESO=C(O)N1CCCC2(CNCO2)C1
InChIInChI=1S/C8H14N2O3/c11-7(12)10-3-1-2-8(5-10)4-9-6-13-8/h9H,1-6H2,(H,11,12)
InChIKeyZFYMOZCFCGLLES-UHFFFAOYSA-N
XLogP0.08
TPSA61.80 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500186.21
LogP ≤ 50.08
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 1-oxa-3,9-diazaspiro[4.5]decane-9-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-oxa-3,9-diazaspiro[4.5]decane-9-carboxylic acid?
The IUPAC name of 1-oxa-3,9-diazaspiro[4.5]decane-9-carboxylic acid (CID 142790989) is 1-oxa-3,9-diazaspiro[4.5]decane-9-carboxylic acid.
What is the SMILES notation for 1-oxa-3,9-diazaspiro[4.5]decane-9-carboxylic acid?
The canonical SMILES for 1-oxa-3,9-diazaspiro[4.5]decane-9-carboxylic acid is O=C(O)N1CCCC2(CNCO2)C1.
What is the InChIKey of 1-oxa-3,9-diazaspiro[4.5]decane-9-carboxylic acid?
The InChIKey is ZFYMOZCFCGLLES-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2O3/c11-7(12)10-3-1-2-8(5-10)4-9-6-13-8/h9H,1-6H2,(H,11,12).
What are the key properties of 1-oxa-3,9-diazaspiro[4.5]decane-9-carboxylic acid?
1-oxa-3,9-diazaspiro[4.5]decane-9-carboxylic acid has a molecular weight of 186.21 g/mol, XLogP of 0.08, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-oxa-3,9-diazaspiro[4.5]decane-9-carboxylic acid is sourced from PubChem (CID 142790989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).