C22H27F3N4O — CID 142791863
2-(2-piperidin-4-ylethylamino)-3-pyridin-4-yl-2-[3-(trifluoromethyl)phenyl]propanamide (PubChem CID 142791863) has the molecular formula C22H27F3N4O and a molecular weight of 420.48 g/mol. Its IUPAC name is 2-(2-piperidin-4-ylethylamino)-3-pyridin-4-yl-2-[3-(trifluoromethyl)phenyl]propanamide.
| Compound Name | 2-(2-piperidin-4-ylethylamino)-3-pyridin-4-yl-2-[3-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 142791863 |
| Molecular Formula | C22H27F3N4O |
| Molecular Weight | 420.48 g/mol |
| Exact Mass | 420.21 |
| IUPAC Name | 2-(2-piperidin-4-ylethylamino)-3-pyridin-4-yl-2-[3-(trifluoromethyl)phenyl]propanamide |
| SMILES | NC(=O)C(Cc1ccncc1)(NCCC1CCNCC1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H27F3N4O/c23-22(24,25)19-3-1-2-18(14-19)21(20(26)30,15-17-6-11-28-12-7-17)29-13-8-16-4-9-27-10-5-16/h1-3,6-7,11-12,14,16,27,29H,4-5,8-10,13,15H2,(H2,26,30) |
| InChIKey | BGTGJMXTUOERPO-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.48 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |