C23H32N4O2 — CID 142792466
2-(4-ethoxyphenyl)-2-(2-piperidin-4-ylethylamino)-3-pyridin-4-ylpropanamide (PubChem CID 142792466) has the molecular formula C23H32N4O2 and a molecular weight of 396.54 g/mol. Its IUPAC name is 2-(4-ethoxyphenyl)-2-(2-piperidin-4-ylethylamino)-3-pyridin-4-ylpropanamide.
| Compound Name | 2-(4-ethoxyphenyl)-2-(2-piperidin-4-ylethylamino)-3-pyridin-4-ylpropanamide |
|---|---|
| PubChem CID | 142792466 |
| Molecular Formula | C23H32N4O2 |
| Molecular Weight | 396.54 g/mol |
| Exact Mass | 396.25 |
| IUPAC Name | 2-(4-ethoxyphenyl)-2-(2-piperidin-4-ylethylamino)-3-pyridin-4-ylpropanamide |
| SMILES | CCOc1ccc(C(Cc2ccncc2)(NCCC2CCNCC2)C(N)=O)cc1 |
| InChI | InChI=1S/C23H32N4O2/c1-2-29-21-5-3-20(4-6-21)23(22(24)28,17-19-9-14-26-15-10-19)27-16-11-18-7-12-25-13-8-18/h3-6,9-10,14-15,18,25,27H,2,7-8,11-13,16-17H2,1H3,(H2,24,28) |
| InChIKey | AVSMFZXLVMEFSF-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.54 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |