About (3-methoxypropylamino) phenyl carbonate
(3-methoxypropylamino) phenyl carbonate (PubChem CID 142793744) has the molecular formula C11H15NO4
and a molecular weight of 225.24 g/mol. Its IUPAC name is (3-methoxypropylamino) phenyl carbonate.
Molecular Properties
| Compound Name | (3-methoxypropylamino) phenyl carbonate |
| PubChem CID | 142793744 |
| Molecular Formula | C11H15NO4 |
| Molecular Weight | 225.24 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | (3-methoxypropylamino) phenyl carbonate |
| SMILES | COCCCNOC(=O)Oc1ccccc1 |
| InChI | InChI=1S/C11H15NO4/c1-14-9-5-8-12-16-11(13)15-10-6-3-2-4-7-10/h2-4,6-7,12H,5,8-9H2,1H3 |
| InChIKey | UCQPDWBNBZTIJQ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.24 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze (3-methoxypropylamino) phenyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methoxypropylamino) phenyl carbonate?
The IUPAC name of (3-methoxypropylamino) phenyl carbonate (CID 142793744) is (3-methoxypropylamino) phenyl carbonate.
What is the SMILES notation for (3-methoxypropylamino) phenyl carbonate?
The canonical SMILES for (3-methoxypropylamino) phenyl carbonate is COCCCNOC(=O)Oc1ccccc1.
What is the InChIKey of (3-methoxypropylamino) phenyl carbonate?
The InChIKey is UCQPDWBNBZTIJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO4/c1-14-9-5-8-12-16-11(13)15-10-6-3-2-4-7-10/h2-4,6-7,12H,5,8-9H2,1H3.
What are the key properties of (3-methoxypropylamino) phenyl carbonate?
(3-methoxypropylamino) phenyl carbonate has a molecular weight of 225.24 g/mol, XLogP of 1.74, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methoxypropylamino) phenyl carbonate is sourced from PubChem (CID 142793744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).