C19H24BNO5S — CID 142794534
5-methoxy-2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzenesulfonamide (PubChem CID 142794534) has the molecular formula C19H24BNO5S and a molecular weight of 389.28 g/mol. Its IUPAC name is 5-methoxy-2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzenesulfonamide.
| Compound Name | 5-methoxy-2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 142794534 |
| Molecular Formula | C19H24BNO5S |
| Molecular Weight | 389.28 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | 5-methoxy-2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzenesulfonamide |
| SMILES | COc1ccc(-c2cccc(B3OC(C)(C)C(C)(C)O3)c2)c(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C19H24BNO5S/c1-18(2)19(3,4)26-20(25-18)14-8-6-7-13(11-14)16-10-9-15(24-5)12-17(16)27(21,22)23/h6-12H,1-5H3,(H2,21,22,23) |
| InChIKey | KUWSQOOQCDXDDB-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.28 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|