C23H31BO3S — CID 144792014
4,4,5,5-tetramethyl-2-[3-[2-methyl-4-(3-methylsulfanylpropoxy)phenyl]phenyl]-1,3,2-dioxaborolane (PubChem CID 144792014) has the molecular formula C23H31BO3S and a molecular weight of 398.38 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[3-[2-methyl-4-(3-methylsulfanylpropoxy)phenyl]phenyl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[3-[2-methyl-4-(3-methylsulfanylpropoxy)phenyl]phenyl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 144792014 |
| Molecular Formula | C23H31BO3S |
| Molecular Weight | 398.38 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[3-[2-methyl-4-(3-methylsulfanylpropoxy)phenyl]phenyl]-1,3,2-dioxaborolane |
| SMILES | CSCCCOc1ccc(-c2cccc(B3OC(C)(C)C(C)(C)O3)c2)c(C)c1 |
| InChI | InChI=1S/C23H31BO3S/c1-17-15-20(25-13-8-14-28-6)11-12-21(17)18-9-7-10-19(16-18)24-26-22(2,3)23(4,5)27-24/h7,9-12,15-16H,8,13-14H2,1-6H3 |
| InChIKey | KHEOLJHTHMAWAG-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.38 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|