C15H16ClF2N3O2 — CID 142795365
2-chloro-5-[(2,6-difluoro-3,5-dimethoxyanilino)methyl]-3-methylpyridin-4-amine (PubChem CID 142795365) has the molecular formula C15H16ClF2N3O2 and a molecular weight of 343.76 g/mol. Its IUPAC name is 2-chloro-5-[(2,6-difluoro-3,5-dimethoxyanilino)methyl]-3-methylpyridin-4-amine.
| Compound Name | 2-chloro-5-[(2,6-difluoro-3,5-dimethoxyanilino)methyl]-3-methylpyridin-4-amine |
|---|---|
| PubChem CID | 142795365 |
| Molecular Formula | C15H16ClF2N3O2 |
| Molecular Weight | 343.76 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | 2-chloro-5-[(2,6-difluoro-3,5-dimethoxyanilino)methyl]-3-methylpyridin-4-amine |
| SMILES | COc1cc(OC)c(F)c(NCc2cnc(Cl)c(C)c2N)c1F |
| InChI | InChI=1S/C15H16ClF2N3O2/c1-7-13(19)8(6-21-15(7)16)5-20-14-11(17)9(22-2)4-10(23-3)12(14)18/h4,6,20H,5H2,1-3H3,(H2,19,21) |
| InChIKey | MAWAHFNQFFEAJM-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.76 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|