C30H41N5O — CID 142796377
2-cyclohexyl-2-[2-[2-cyclohexyl-6-(diethylamino)-3-pyridinyl]benzimidazol-1-yl]acetamide (PubChem CID 142796377) has the molecular formula C30H41N5O and a molecular weight of 487.69 g/mol. Its IUPAC name is 2-cyclohexyl-2-[2-[2-cyclohexyl-6-(diethylamino)-3-pyridinyl]benzimidazol-1-yl]acetamide.
| Compound Name | 2-cyclohexyl-2-[2-[2-cyclohexyl-6-(diethylamino)-3-pyridinyl]benzimidazol-1-yl]acetamide |
|---|---|
| PubChem CID | 142796377 |
| Molecular Formula | C30H41N5O |
| Molecular Weight | 487.69 g/mol |
| Exact Mass | 487.33 |
| IUPAC Name | 2-cyclohexyl-2-[2-[2-cyclohexyl-6-(diethylamino)-3-pyridinyl]benzimidazol-1-yl]acetamide |
| SMILES | CCN(CC)c1ccc(-c2nc3ccccc3n2C(C(N)=O)C2CCCCC2)c(C2CCCCC2)n1 |
| InChI | InChI=1S/C30H41N5O/c1-3-34(4-2)26-20-19-23(27(33-26)21-13-7-5-8-14-21)30-32-24-17-11-12-18-25(24)35(30)28(29(31)36)22-15-9-6-10-16-22/h11-12,17-22,28H,3-10,13-16H2,1-2H3,(H2,31,36) |
| InChIKey | LIPLQZQKJBVWCN-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.69 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |