C13H9ClF3N3O2 — CID 142796514
2-chloro-3-[4-(2,2,2-trifluoroethoxy)-3-pyridinyl]pyridine-4-carboxamide (PubChem CID 142796514) has the molecular formula C13H9ClF3N3O2 and a molecular weight of 331.68 g/mol. Its IUPAC name is 2-chloro-3-[4-(2,2,2-trifluoroethoxy)-3-pyridinyl]pyridine-4-carboxamide.
| Compound Name | 2-chloro-3-[4-(2,2,2-trifluoroethoxy)-3-pyridinyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 142796514 |
| Molecular Formula | C13H9ClF3N3O2 |
| Molecular Weight | 331.68 g/mol |
| Exact Mass | 331.03 |
| IUPAC Name | 2-chloro-3-[4-(2,2,2-trifluoroethoxy)-3-pyridinyl]pyridine-4-carboxamide |
| SMILES | NC(=O)c1ccnc(Cl)c1-c1cnccc1OCC(F)(F)F |
| InChI | InChI=1S/C13H9ClF3N3O2/c14-11-10(7(12(18)21)1-4-20-11)8-5-19-3-2-9(8)22-6-13(15,16)17/h1-5H,6H2,(H2,18,21) |
| InChIKey | BGDOFLVSOCWSGT-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.68 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|