About 2-chloro-3-[4-(2,2,2-trifluoroethoxy)-3-pyridinyl]pyridine-4-carboxamide
2-chloro-3-[4-(2,2,2-trifluoroethoxy)-3-pyridinyl]pyridine-4-carboxamide (PubChem CID 142796514) has the molecular formula C13H9ClF3N3O2
and a molecular weight of 331.68 g/mol. Its IUPAC name is 2-chloro-3-[4-(2,2,2-trifluoroethoxy)-3-pyridinyl]pyridine-4-carboxamide.
Molecular Properties
| Compound Name | 2-chloro-3-[4-(2,2,2-trifluoroethoxy)-3-pyridinyl]pyridine-4-carboxamide |
| PubChem CID | 142796514 |
| Molecular Formula | C13H9ClF3N3O2 |
| Molecular Weight | 331.68 g/mol |
| Exact Mass | 331.03 |
| IUPAC Name | 2-chloro-3-[4-(2,2,2-trifluoroethoxy)-3-pyridinyl]pyridine-4-carboxamide |
| SMILES | NC(=O)c1ccnc(Cl)c1-c1cnccc1OCC(F)(F)F |
| InChI | InChI=1S/C13H9ClF3N3O2/c14-11-10(7(12(18)21)1-4-20-11)8-5-19-3-2-9(8)22-6-13(15,16)17/h1-5H,6H2,(H2,18,21) |
| InChIKey | BGDOFLVSOCWSGT-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.68 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-3-[4-(2,2,2-trifluoroethoxy)-3-pyridinyl]pyridine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-3-[4-(2,2,2-trifluoroethoxy)-3-pyridinyl]pyridine-4-carboxamide?
The IUPAC name of 2-chloro-3-[4-(2,2,2-trifluoroethoxy)-3-pyridinyl]pyridine-4-carboxamide (CID 142796514) is 2-chloro-3-[4-(2,2,2-trifluoroethoxy)-3-pyridinyl]pyridine-4-carboxamide.
What is the SMILES notation for 2-chloro-3-[4-(2,2,2-trifluoroethoxy)-3-pyridinyl]pyridine-4-carboxamide?
The canonical SMILES for 2-chloro-3-[4-(2,2,2-trifluoroethoxy)-3-pyridinyl]pyridine-4-carboxamide is NC(=O)c1ccnc(Cl)c1-c1cnccc1OCC(F)(F)F.
What is the InChIKey of 2-chloro-3-[4-(2,2,2-trifluoroethoxy)-3-pyridinyl]pyridine-4-carboxamide?
The InChIKey is BGDOFLVSOCWSGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9ClF3N3O2/c14-11-10(7(12(18)21)1-4-20-11)8-5-19-3-2-9(8)22-6-13(15,16)17/h1-5H,6H2,(H2,18,21).
What are the key properties of 2-chloro-3-[4-(2,2,2-trifluoroethoxy)-3-pyridinyl]pyridine-4-carboxamide?
2-chloro-3-[4-(2,2,2-trifluoroethoxy)-3-pyridinyl]pyridine-4-carboxamide has a molecular weight of 331.68 g/mol, XLogP of 2.84, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-3-[4-(2,2,2-trifluoroethoxy)-3-pyridinyl]pyridine-4-carboxamide is sourced from PubChem (CID 142796514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).