C6H7N5 — CID 142798421
2-(1,3-dihydro-1,2,4-triazol-2-yl)pyrazine (PubChem CID 142798421) has the molecular formula C6H7N5 and a molecular weight of 149.16 g/mol. Its IUPAC name is 2-(1,3-dihydro-1,2,4-triazol-2-yl)pyrazine.
| Compound Name | 2-(1,3-dihydro-1,2,4-triazol-2-yl)pyrazine |
|---|---|
| PubChem CID | 142798421 |
| Molecular Formula | C6H7N5 |
| Molecular Weight | 149.16 g/mol |
| Exact Mass | 149.07 |
| IUPAC Name | 2-(1,3-dihydro-1,2,4-triazol-2-yl)pyrazine |
| SMILES | C1=NCN(c2cnccn2)N1 |
| InChI | InChI=1S/C6H7N5/c1-2-9-6(3-7-1)11-5-8-4-10-11/h1-4H,5H2,(H,8,10) |
| InChIKey | KHMZXWMZUFAQQR-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 53.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.16 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |