About (2-hydroxyethylamino)methyl pyridine-2-carboxylate
(2-hydroxyethylamino)methyl pyridine-2-carboxylate (PubChem CID 142799656) has the molecular formula C9H12N2O3
and a molecular weight of 196.21 g/mol. Its IUPAC name is (2-hydroxyethylamino)methyl pyridine-2-carboxylate.
Molecular Properties
| Compound Name | (2-hydroxyethylamino)methyl pyridine-2-carboxylate |
| PubChem CID | 142799656 |
| Molecular Formula | C9H12N2O3 |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | (2-hydroxyethylamino)methyl pyridine-2-carboxylate |
| SMILES | O=C(OCNCCO)c1ccccn1 |
| InChI | InChI=1S/C9H12N2O3/c12-6-5-10-7-14-9(13)8-3-1-2-4-11-8/h1-4,10,12H,5-7H2 |
| InChIKey | KWZIAGLXSKYOIO-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (2-hydroxyethylamino)methyl pyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-hydroxyethylamino)methyl pyridine-2-carboxylate?
The IUPAC name of (2-hydroxyethylamino)methyl pyridine-2-carboxylate (CID 142799656) is (2-hydroxyethylamino)methyl pyridine-2-carboxylate.
What is the SMILES notation for (2-hydroxyethylamino)methyl pyridine-2-carboxylate?
The canonical SMILES for (2-hydroxyethylamino)methyl pyridine-2-carboxylate is O=C(OCNCCO)c1ccccn1.
What is the InChIKey of (2-hydroxyethylamino)methyl pyridine-2-carboxylate?
The InChIKey is KWZIAGLXSKYOIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O3/c12-6-5-10-7-14-9(13)8-3-1-2-4-11-8/h1-4,10,12H,5-7H2.
What are the key properties of (2-hydroxyethylamino)methyl pyridine-2-carboxylate?
(2-hydroxyethylamino)methyl pyridine-2-carboxylate has a molecular weight of 196.21 g/mol, XLogP of -0.22, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-hydroxyethylamino)methyl pyridine-2-carboxylate is sourced from PubChem (CID 142799656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).