About 2-(pyridazin-3-ylamino)ethyl pyridine-2-carboxylate
2-(pyridazin-3-ylamino)ethyl pyridine-2-carboxylate (PubChem CID 71973059) has the molecular formula C12H12N4O2
and a molecular weight of 244.25 g/mol. Its IUPAC name is 2-(pyridazin-3-ylamino)ethyl pyridine-2-carboxylate.
Molecular Properties
| Compound Name | 2-(pyridazin-3-ylamino)ethyl pyridine-2-carboxylate |
| PubChem CID | 71973059 |
| Molecular Formula | C12H12N4O2 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | 2-(pyridazin-3-ylamino)ethyl pyridine-2-carboxylate |
| SMILES | O=C(OCCNc1cccnn1)c1ccccn1 |
| InChI | InChI=1S/C12H12N4O2/c17-12(10-4-1-2-6-13-10)18-9-8-14-11-5-3-7-15-16-11/h1-7H,8-9H2,(H,14,16) |
| InChIKey | NADJIYFOZAPVLM-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(pyridazin-3-ylamino)ethyl pyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(pyridazin-3-ylamino)ethyl pyridine-2-carboxylate?
The IUPAC name of 2-(pyridazin-3-ylamino)ethyl pyridine-2-carboxylate (CID 71973059) is 2-(pyridazin-3-ylamino)ethyl pyridine-2-carboxylate.
What is the SMILES notation for 2-(pyridazin-3-ylamino)ethyl pyridine-2-carboxylate?
The canonical SMILES for 2-(pyridazin-3-ylamino)ethyl pyridine-2-carboxylate is O=C(OCCNc1cccnn1)c1ccccn1.
What is the InChIKey of 2-(pyridazin-3-ylamino)ethyl pyridine-2-carboxylate?
The InChIKey is NADJIYFOZAPVLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N4O2/c17-12(10-4-1-2-6-13-10)18-9-8-14-11-5-3-7-15-16-11/h1-7H,8-9H2,(H,14,16).
What are the key properties of 2-(pyridazin-3-ylamino)ethyl pyridine-2-carboxylate?
2-(pyridazin-3-ylamino)ethyl pyridine-2-carboxylate has a molecular weight of 244.25 g/mol, XLogP of 1.14, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(pyridazin-3-ylamino)ethyl pyridine-2-carboxylate is sourced from PubChem (CID 71973059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).