C13H19NO4 — CID 142805893
ethane;methyl (2E,4Z)-2-[(1E)-1-nitrobuta-1,3-dienyl]hexa-2,4-dienoate (PubChem CID 142805893) has the molecular formula C13H19NO4 and a molecular weight of 253.30 g/mol. Its IUPAC name is ethane;methyl (2E,4Z)-2-[(1E)-1-nitrobuta-1,3-dienyl]hexa-2,4-dienoate.
| Compound Name | ethane;methyl (2E,4Z)-2-[(1E)-1-nitrobuta-1,3-dienyl]hexa-2,4-dienoate |
|---|---|
| PubChem CID | 142805893 |
| Molecular Formula | C13H19NO4 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | ethane;methyl (2E,4Z)-2-[(1E)-1-nitrobuta-1,3-dienyl]hexa-2,4-dienoate |
| SMILES | C=C/C=C(C(=C/C=C\C)\C(=O)OC)/[N+](=O)[O-].CC |
| InChI | InChI=1S/C11H13NO4.C2H6/c1-4-6-8-9(11(13)16-3)10(7-5-2)12(14)15;1-2/h4-8H,2H2,1,3H3;1-2H3/b6-4-,9-8+,10-7+; |
| InChIKey | CEMRXSDQJIGXBH-NAJSNDRSSA-N |
| XLogP | 3.03 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|