C77H103O9P2S2 — CID 142806955
CID 142806955 (PubChem CID 142806955) has the molecular formula C77H103O9P2S2 and a molecular weight of 1298.74 g/mol.
| Compound Name | CID 142806955 |
|---|---|
| PubChem CID | 142806955 |
| Molecular Formula | C77H103O9P2S2 |
| Molecular Weight | 1298.74 g/mol |
| Exact Mass | 1297.65 |
| IUPAC Name | — |
| SMILES | CCC(CC)(OPC)C(=O)C1=C[CH]1.Cc1cc(C)c(-c2cc(-c3cc(-c4c(C)cc(C)cc4C)cc(S(C)(C)C)c3Op3oc4c(C(C)(C)C)cc(OC(=O)C(C)(C)C)cc4c4cc(OC(=O)C(C)(C)C)cc(C(C)(C)C)c4o3)c(C)c(S(C)(C)C)c2)c(C)c1 |
| InChI | InChI=1S/C67H87O7PS2.C10H16O2P/c1-38-26-40(3)57(41(4)27-38)45-30-49(44(7)55(32-45)76(20,21)22)50-31-46(58-42(5)28-39(2)29-43(58)6)33-56(77(23,24)25)61(50)74-75-72-59-51(34-47(36-53(59)64(8,9)10)70-62(68)66(14,15)16)52-35-48(71-63(69)67(17,18)19)37-54(60(52)73-75)65(11,12)13;1-4-10(5-2,12-13-3)9(11)8-6-7-8/h26-37H,1-25H3;6-7,13H,4-5H2,1-3H3 |
| InChIKey | KSEQOEWGHBMPFA-UHFFFAOYSA-N |
| XLogP | 22.39 |
| TPSA | 114.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 90 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1298.74 |
| LogP ≤ 5 | 22.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|