C25H38N4O5 — CID 142810369
3-[[2-[[(Z)-4-(dimethylamino)-2-methoxybut-2-enyl]amino]-3-hydroxy-4-oxocyclobuten-1-yl]amino]-2-hydroxy-N,N-dimethylbenzamide;ethane;prop-1-yne (PubChem CID 142810369) has the molecular formula C25H38N4O5 and a molecular weight of 474.60 g/mol. Its IUPAC name is 3-[[2-[[(Z)-4-(dimethylamino)-2-methoxybut-2-enyl]amino]-3-hydroxy-4-oxocyclobuten-1-yl]amino]-2-hydroxy-N,N-dimethylbenzamide;ethane;prop-1-yne.
| Compound Name | 3-[[2-[[(Z)-4-(dimethylamino)-2-methoxybut-2-enyl]amino]-3-hydroxy-4-oxocyclobuten-1-yl]amino]-2-hydroxy-N,N-dimethylbenzamide;ethane;prop-1-yne |
|---|---|
| PubChem CID | 142810369 |
| Molecular Formula | C25H38N4O5 |
| Molecular Weight | 474.60 g/mol |
| Exact Mass | 474.28 |
| IUPAC Name | 3-[[2-[[(Z)-4-(dimethylamino)-2-methoxybut-2-enyl]amino]-3-hydroxy-4-oxocyclobuten-1-yl]amino]-2-hydroxy-N,N-dimethylbenzamide;ethane;prop-1-yne |
| SMILES | C#CC.CC.CO/C(=C\CN(C)C)CNC1=C(Nc2cccc(C(=O)N(C)C)c2O)C(=O)C1O |
| InChI | InChI=1S/C20H28N4O5.C3H4.C2H6/c1-23(2)10-9-12(29-5)11-21-15-16(19(27)18(15)26)22-14-8-6-7-13(17(14)25)20(28)24(3)4;1-3-2;1-2/h6-9,18,21-22,25-26H,10-11H2,1-5H3;1H,2H3;1-2H3/b12-9-;; |
| InChIKey | MMTMLGLMXNIJNO-AGZDHKJJSA-N |
| XLogP | 2.01 |
| TPSA | 114.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.60 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|