C18H25N5O3S — CID 143076838
3-[[4-[[(Z)-2-ethoxypent-2-enyl]amino]-1,2,5-thiadiazol-3-yl]amino]-2-hydroxy-N,N-dimethylbenzamide (PubChem CID 143076838) has the molecular formula C18H25N5O3S and a molecular weight of 391.50 g/mol. Its IUPAC name is 3-[[4-[[(Z)-2-ethoxypent-2-enyl]amino]-1,2,5-thiadiazol-3-yl]amino]-2-hydroxy-N,N-dimethylbenzamide.
| Compound Name | 3-[[4-[[(Z)-2-ethoxypent-2-enyl]amino]-1,2,5-thiadiazol-3-yl]amino]-2-hydroxy-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 143076838 |
| Molecular Formula | C18H25N5O3S |
| Molecular Weight | 391.50 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | 3-[[4-[[(Z)-2-ethoxypent-2-enyl]amino]-1,2,5-thiadiazol-3-yl]amino]-2-hydroxy-N,N-dimethylbenzamide |
| SMILES | CC/C=C(/CNc1nsnc1Nc1cccc(C(=O)N(C)C)c1O)OCC |
| InChI | InChI=1S/C18H25N5O3S/c1-5-8-12(26-6-2)11-19-16-17(22-27-21-16)20-14-10-7-9-13(15(14)24)18(25)23(3)4/h7-10,24H,5-6,11H2,1-4H3,(H,19,21)(H,20,22)/b12-8- |
| InChIKey | QCQURNQUTBHXNR-WQLSENKSSA-N |
| XLogP | 3.43 |
| TPSA | 99.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.50 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|