C41H51N3O3 — CID 142815275
N-(1,3-benzodioxol-5-ylmethyl)-N-[(3-methoxy-5-propylphenyl)methyl]ethanamine;N'-pentyl-N-(1-phenylethenyl)benzenecarboximidamide (PubChem CID 142815275) has the molecular formula C41H51N3O3 and a molecular weight of 633.88 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-N-[(3-methoxy-5-propylphenyl)methyl]ethanamine;N'-pentyl-N-(1-phenylethenyl)benzenecarboximidamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-N-[(3-methoxy-5-propylphenyl)methyl]ethanamine;N'-pentyl-N-(1-phenylethenyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 142815275 |
| Molecular Formula | C41H51N3O3 |
| Molecular Weight | 633.88 g/mol |
| Exact Mass | 633.39 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-N-[(3-methoxy-5-propylphenyl)methyl]ethanamine;N'-pentyl-N-(1-phenylethenyl)benzenecarboximidamide |
| SMILES | C=C(N/C(=N\CCCCC)c1ccccc1)c1ccccc1.CCCc1cc(CN(CC)Cc2ccc3c(c2)OCO3)cc(OC)c1 |
| InChI | InChI=1S/C21H27NO3.C20H24N2/c1-4-6-16-9-18(11-19(10-16)23-3)14-22(5-2)13-17-7-8-20-21(12-17)25-15-24-20;1-3-4-11-16-21-20(19-14-9-6-10-15-19)22-17(2)18-12-7-5-8-13-18/h7-12H,4-6,13-15H2,1-3H3;5-10,12-15H,2-4,11,16H2,1H3,(H,21,22) |
| InChIKey | UKMPYLNGYWENLZ-UHFFFAOYSA-N |
| XLogP | 9.28 |
| TPSA | 55.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.88 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|