C34H37F4N3O3 — CID 142815388
N-[(E)-3-[1,3-benzodioxol-5-ylmethyl-[(E)-4-(1,1,2,2-tetrafluoroethoxy)pent-3-enyl]amino]-1-(3,5-dimethylphenyl)prop-1-enyl]-N'-methylbenzenecarboximidamide (PubChem CID 142815388) has the molecular formula C34H37F4N3O3 and a molecular weight of 611.68 g/mol. Its IUPAC name is N-[(E)-3-[1,3-benzodioxol-5-ylmethyl-[(E)-4-(1,1,2,2-tetrafluoroethoxy)pent-3-enyl]amino]-1-(3,5-dimethylphenyl)prop-1-enyl]-N'-methylbenzenecarboximidamide.
| Compound Name | N-[(E)-3-[1,3-benzodioxol-5-ylmethyl-[(E)-4-(1,1,2,2-tetrafluoroethoxy)pent-3-enyl]amino]-1-(3,5-dimethylphenyl)prop-1-enyl]-N'-methylbenzenecarboximidamide |
|---|---|
| PubChem CID | 142815388 |
| Molecular Formula | C34H37F4N3O3 |
| Molecular Weight | 611.68 g/mol |
| Exact Mass | 611.28 |
| IUPAC Name | N-[(E)-3-[1,3-benzodioxol-5-ylmethyl-[(E)-4-(1,1,2,2-tetrafluoroethoxy)pent-3-enyl]amino]-1-(3,5-dimethylphenyl)prop-1-enyl]-N'-methylbenzenecarboximidamide |
| SMILES | C/N=C(/N/C(=C/CN(CC/C=C(\C)OC(F)(F)C(F)F)Cc1ccc2c(c1)OCO2)c1cc(C)cc(C)c1)c1ccccc1 |
| InChI | InChI=1S/C34H37F4N3O3/c1-23-17-24(2)19-28(18-23)29(40-32(39-4)27-10-6-5-7-11-27)14-16-41(15-8-9-25(3)44-34(37,38)33(35)36)21-26-12-13-30-31(20-26)43-22-42-30/h5-7,9-14,17-20,33H,8,15-16,21-22H2,1-4H3,(H,39,40)/b25-9+,29-14+ |
| InChIKey | YGCVGPWQKBVBHP-JATYAECMSA-N |
| XLogP | 7.71 |
| TPSA | 55.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.68 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|