C24H23FN2O3 — CID 142815798
6-[2-[2-[(4-fluorophenyl)methoxy]-5-methylphenyl]cyclopentyl]pyrazine-2-carboxylic acid (PubChem CID 142815798) has the molecular formula C24H23FN2O3 and a molecular weight of 406.46 g/mol. Its IUPAC name is 6-[2-[2-[(4-fluorophenyl)methoxy]-5-methylphenyl]cyclopentyl]pyrazine-2-carboxylic acid.
| Compound Name | 6-[2-[2-[(4-fluorophenyl)methoxy]-5-methylphenyl]cyclopentyl]pyrazine-2-carboxylic acid |
|---|---|
| PubChem CID | 142815798 |
| Molecular Formula | C24H23FN2O3 |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | 6-[2-[2-[(4-fluorophenyl)methoxy]-5-methylphenyl]cyclopentyl]pyrazine-2-carboxylic acid |
| SMILES | Cc1ccc(OCc2ccc(F)cc2)c(C2CCCC2c2cncc(C(=O)O)n2)c1 |
| InChI | InChI=1S/C24H23FN2O3/c1-15-5-10-23(30-14-16-6-8-17(25)9-7-16)20(11-15)18-3-2-4-19(18)21-12-26-13-22(27-21)24(28)29/h5-13,18-19H,2-4,14H2,1H3,(H,28,29) |
| InChIKey | SURGHHPGWQSKQO-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |