C11H13FN2O — CID 142816300
3-[(3E,6Z)-8-fluoroocta-1,3,6-trien-4-yl]-5-methyl-1,2,4-oxadiazole (PubChem CID 142816300) has the molecular formula C11H13FN2O and a molecular weight of 208.24 g/mol. Its IUPAC name is 3-[(3E,6Z)-8-fluoroocta-1,3,6-trien-4-yl]-5-methyl-1,2,4-oxadiazole.
| Compound Name | 3-[(3E,6Z)-8-fluoroocta-1,3,6-trien-4-yl]-5-methyl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 142816300 |
| Molecular Formula | C11H13FN2O |
| Molecular Weight | 208.24 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | 3-[(3E,6Z)-8-fluoroocta-1,3,6-trien-4-yl]-5-methyl-1,2,4-oxadiazole |
| SMILES | C=C/C=C(\C/C=C\CF)c1noc(C)n1 |
| InChI | InChI=1S/C11H13FN2O/c1-3-6-10(7-4-5-8-12)11-13-9(2)15-14-11/h3-6H,1,7-8H2,2H3/b5-4-,10-6+ |
| InChIKey | GRIAQYOHLBISFZ-VWJYOPCBSA-N |
| XLogP | 2.86 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.24 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|