C5H6N4O2 — CID 142609208
methanimidoyl 5-methyl-1,2,4-oxadiazole-3-carboximidate (PubChem CID 142609208) has the molecular formula C5H6N4O2 and a molecular weight of 154.13 g/mol. Its IUPAC name is methanimidoyl 5-methyl-1,2,4-oxadiazole-3-carboximidate.
| Compound Name | methanimidoyl 5-methyl-1,2,4-oxadiazole-3-carboximidate |
|---|---|
| PubChem CID | 142609208 |
| Molecular Formula | C5H6N4O2 |
| Molecular Weight | 154.13 g/mol |
| Exact Mass | 154.05 |
| IUPAC Name | methanimidoyl 5-methyl-1,2,4-oxadiazole-3-carboximidate |
| SMILES | [H]/N=C(\O/C=N/[H])c1noc(C)n1 |
| InChI | InChI=1S/C5H6N4O2/c1-3-8-5(9-11-3)4(7)10-2-6/h2,6-7H,1H3/b6-2+,7-4- |
| InChIKey | OPCJYHLCDPWUBM-HVAWZRNZSA-N |
| XLogP | 0.33 |
| TPSA | 95.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.13 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|