C10H13NOS3 — CID 142816806
3-[bis(sulfanyl)amino]-3-(4-methylphenyl)propanethioic S-acid (PubChem CID 142816806) has the molecular formula C10H13NOS3 and a molecular weight of 259.42 g/mol. Its IUPAC name is 3-[bis(sulfanyl)amino]-3-(4-methylphenyl)propanethioic S-acid.
| Compound Name | 3-[bis(sulfanyl)amino]-3-(4-methylphenyl)propanethioic S-acid |
|---|---|
| PubChem CID | 142816806 |
| Molecular Formula | C10H13NOS3 |
| Molecular Weight | 259.42 g/mol |
| Exact Mass | 259.02 |
| IUPAC Name | 3-[bis(sulfanyl)amino]-3-(4-methylphenyl)propanethioic S-acid |
| SMILES | Cc1ccc(C(CC(=O)S)N(S)S)cc1 |
| InChI | InChI=1S/C10H13NOS3/c1-7-2-4-8(5-3-7)9(11(14)15)6-10(12)13/h2-5,9,14-15H,6H2,1H3,(H,12,13) |
| InChIKey | OOCWDKYQTVYJIF-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.42 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|