C15H27NO — CID 142821696
N-[(6Z,9Z)-5-methyldodeca-6,9-dienyl]acetamide (PubChem CID 142821696) has the molecular formula C15H27NO and a molecular weight of 237.39 g/mol. Its IUPAC name is N-[(6Z,9Z)-5-methyldodeca-6,9-dienyl]acetamide.
| Compound Name | N-[(6Z,9Z)-5-methyldodeca-6,9-dienyl]acetamide |
|---|---|
| PubChem CID | 142821696 |
| Molecular Formula | C15H27NO |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.21 |
| IUPAC Name | N-[(6Z,9Z)-5-methyldodeca-6,9-dienyl]acetamide |
| SMILES | CC/C=C\C/C=C\C(C)CCCCNC(C)=O |
| InChI | InChI=1S/C15H27NO/c1-4-5-6-7-8-11-14(2)12-9-10-13-16-15(3)17/h5-6,8,11,14H,4,7,9-10,12-13H2,1-3H3,(H,16,17)/b6-5-,11-8- |
| InChIKey | VYSQOTCPYVIHKL-VRULOHATSA-N |
| XLogP | 3.84 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|