C9H8O4 — CID 14282792
4,6-dihydroxy-7-methyl-1-benzofuran-3-one (PubChem CID 14282792) has the molecular formula C9H8O4 and a molecular weight of 180.16 g/mol. Its IUPAC name is 4,6-dihydroxy-7-methyl-1-benzofuran-3-one.
| Compound Name | 4,6-dihydroxy-7-methyl-1-benzofuran-3-one |
|---|---|
| PubChem CID | 14282792 |
| Molecular Formula | C9H8O4 |
| Molecular Weight | 180.16 g/mol |
| Exact Mass | 180.04 |
| IUPAC Name | 4,6-dihydroxy-7-methyl-1-benzofuran-3-one |
| SMILES | Cc1c(O)cc(O)c2c1OCC2=O |
| InChI | InChI=1S/C9H8O4/c1-4-5(10)2-6(11)8-7(12)3-13-9(4)8/h2,10-11H,3H2,1H3 |
| InChIKey | ZKCHMSIFNQQWBH-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.16 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |