C24H36N4OS2 — CID 142830456
(1-prop-2-enylcyclohexyl)methyl N'-[[4-(2-pyrrolidin-1-ylethoxy)phenyl]carbamothioyl]carbamimidothioate (PubChem CID 142830456) has the molecular formula C24H36N4OS2 and a molecular weight of 460.71 g/mol. Its IUPAC name is (1-prop-2-enylcyclohexyl)methyl N'-[[4-(2-pyrrolidin-1-ylethoxy)phenyl]carbamothioyl]carbamimidothioate.
| Compound Name | (1-prop-2-enylcyclohexyl)methyl N'-[[4-(2-pyrrolidin-1-ylethoxy)phenyl]carbamothioyl]carbamimidothioate |
|---|---|
| PubChem CID | 142830456 |
| Molecular Formula | C24H36N4OS2 |
| Molecular Weight | 460.71 g/mol |
| Exact Mass | 460.23 |
| IUPAC Name | (1-prop-2-enylcyclohexyl)methyl N'-[[4-(2-pyrrolidin-1-ylethoxy)phenyl]carbamothioyl]carbamimidothioate |
| SMILES | C=CCC1(CS/C(N)=N/C(=S)Nc2ccc(OCCN3CCCC3)cc2)CCCCC1 |
| InChI | InChI=1S/C24H36N4OS2/c1-2-12-24(13-4-3-5-14-24)19-31-22(25)27-23(30)26-20-8-10-21(11-9-20)29-18-17-28-15-6-7-16-28/h2,8-11H,1,3-7,12-19H2,(H3,25,26,27,30) |
| InChIKey | OTIMQXFXGZCNKK-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 62.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.71 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|