C24H19N4OP — CID 142830737
(NE)-N-[2-[2-(8-phenylimidazo[4,5-c]quinolin-1-yl)phenyl]-1-phosphanylethylidene]hydroxylamine (PubChem CID 142830737) has the molecular formula C24H19N4OP and a molecular weight of 410.42 g/mol. Its IUPAC name is (NE)-N-[2-[2-(8-phenylimidazo[4,5-c]quinolin-1-yl)phenyl]-1-phosphanylethylidene]hydroxylamine.
| Compound Name | (NE)-N-[2-[2-(8-phenylimidazo[4,5-c]quinolin-1-yl)phenyl]-1-phosphanylethylidene]hydroxylamine |
|---|---|
| PubChem CID | 142830737 |
| Molecular Formula | C24H19N4OP |
| Molecular Weight | 410.42 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | (NE)-N-[2-[2-(8-phenylimidazo[4,5-c]quinolin-1-yl)phenyl]-1-phosphanylethylidene]hydroxylamine |
| SMILES | O/N=C(/P)Cc1ccccc1-n1cnc2cnc3ccc(-c4ccccc4)cc3c21 |
| InChI | InChI=1S/C24H19N4OP/c29-27-23(30)13-18-8-4-5-9-22(18)28-15-26-21-14-25-20-11-10-17(12-19(20)24(21)28)16-6-2-1-3-7-16/h1-12,14-15,29H,13,30H2/b27-23+ |
| InChIKey | GBSXAIDUZPWBCD-SLEBQGDGSA-N |
| XLogP | 5.45 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.42 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|