C9H9NOS2 — CID 142832894
2-methyl-5-methylsulfanyloxythieno[3,2-b]pyridine (PubChem CID 142832894) has the molecular formula C9H9NOS2 and a molecular weight of 211.31 g/mol. Its IUPAC name is 2-methyl-5-methylsulfanyloxythieno[3,2-b]pyridine.
| Compound Name | 2-methyl-5-methylsulfanyloxythieno[3,2-b]pyridine |
|---|---|
| PubChem CID | 142832894 |
| Molecular Formula | C9H9NOS2 |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.01 |
| IUPAC Name | 2-methyl-5-methylsulfanyloxythieno[3,2-b]pyridine |
| SMILES | CSOc1ccc2sc(C)cc2n1 |
| InChI | InChI=1S/C9H9NOS2/c1-6-5-7-8(13-6)3-4-9(10-7)11-12-2/h3-5H,1-2H3 |
| InChIKey | CTGWUOQICXCKST-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|