C10H12N2S2 — CID 119083600
N,N-dimethyl-2-methylsulfanyl-1,3-benzothiazol-5-amine (PubChem CID 119083600) has the molecular formula C10H12N2S2 and a molecular weight of 224.35 g/mol. Its IUPAC name is N,N-dimethyl-2-methylsulfanyl-1,3-benzothiazol-5-amine.
| Compound Name | N,N-dimethyl-2-methylsulfanyl-1,3-benzothiazol-5-amine |
|---|---|
| PubChem CID | 119083600 |
| Molecular Formula | C10H12N2S2 |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.04 |
| IUPAC Name | N,N-dimethyl-2-methylsulfanyl-1,3-benzothiazol-5-amine |
| SMILES | CSc1nc2cc(N(C)C)ccc2s1 |
| InChI | InChI=1S/C10H12N2S2/c1-12(2)7-4-5-9-8(6-7)11-10(13-3)14-9/h4-6H,1-3H3 |
| InChIKey | DHPIQLPCKXHCIV-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_P(1)', 'substructure': 'N/A'} |
|---|