C12H15N — CID 142834020
7a,8-dihydrocyclopropa[i]quinoline;ethane (PubChem CID 142834020) has the molecular formula C12H15N and a molecular weight of 173.26 g/mol. Its IUPAC name is 7a,8-dihydrocyclopropa[i]quinoline;ethane.
| Compound Name | 7a,8-dihydrocyclopropa[i]quinoline;ethane |
|---|---|
| PubChem CID | 142834020 |
| Molecular Formula | C12H15N |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | 7a,8-dihydrocyclopropa[i]quinoline;ethane |
| SMILES | C1=CC2=CC=CC3CC23N=C1.CC |
| InChI | InChI=1S/C10H9N.C2H6/c1-3-8-5-2-6-11-10(8)7-9(10)4-1;1-2/h1-6,9H,7H2;1-2H3 |
| InChIKey | KCFTWWIBMBARHT-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |