C31H35ClN2 — CID 142834095
buta-1,3-diene;N-[[3-[(E)-3-chlorobut-2-enyl]-1-ethylindol-5-yl]methyl]-1-naphthalen-1-ylethanamine (PubChem CID 142834095) has the molecular formula C31H35ClN2 and a molecular weight of 471.09 g/mol. Its IUPAC name is buta-1,3-diene;N-[[3-[(E)-3-chlorobut-2-enyl]-1-ethylindol-5-yl]methyl]-1-naphthalen-1-ylethanamine.
| Compound Name | buta-1,3-diene;N-[[3-[(E)-3-chlorobut-2-enyl]-1-ethylindol-5-yl]methyl]-1-naphthalen-1-ylethanamine |
|---|---|
| PubChem CID | 142834095 |
| Molecular Formula | C31H35ClN2 |
| Molecular Weight | 471.09 g/mol |
| Exact Mass | 470.25 |
| IUPAC Name | buta-1,3-diene;N-[[3-[(E)-3-chlorobut-2-enyl]-1-ethylindol-5-yl]methyl]-1-naphthalen-1-ylethanamine |
| SMILES | C=CC=C.CCn1cc(C/C=C(\C)Cl)c2cc(CNC(C)c3cccc4ccccc34)ccc21 |
| InChI | InChI=1S/C27H29ClN2.C4H6/c1-4-30-18-23(14-12-19(2)28)26-16-21(13-15-27(26)30)17-29-20(3)24-11-7-9-22-8-5-6-10-25(22)24;1-3-4-2/h5-13,15-16,18,20,29H,4,14,17H2,1-3H3;3-4H,1-2H2/b19-12+; |
| InChIKey | IQNFYBCCKLPDMF-NNTHFVATSA-N |
| XLogP | 8.71 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.09 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|