C27H29FN2 — CID 142834106
N-[[1-ethyl-3-[(E)-3-fluorobut-2-enyl]indol-5-yl]methyl]-1-naphthalen-1-ylethanamine (PubChem CID 142834106) has the molecular formula C27H29FN2 and a molecular weight of 400.54 g/mol. Its IUPAC name is N-[[1-ethyl-3-[(E)-3-fluorobut-2-enyl]indol-5-yl]methyl]-1-naphthalen-1-ylethanamine.
| Compound Name | N-[[1-ethyl-3-[(E)-3-fluorobut-2-enyl]indol-5-yl]methyl]-1-naphthalen-1-ylethanamine |
|---|---|
| PubChem CID | 142834106 |
| Molecular Formula | C27H29FN2 |
| Molecular Weight | 400.54 g/mol |
| Exact Mass | 400.23 |
| IUPAC Name | N-[[1-ethyl-3-[(E)-3-fluorobut-2-enyl]indol-5-yl]methyl]-1-naphthalen-1-ylethanamine |
| SMILES | CCn1cc(C/C=C(\C)F)c2cc(CNC(C)c3cccc4ccccc34)ccc21 |
| InChI | InChI=1S/C27H29FN2/c1-4-30-18-23(14-12-19(2)28)26-16-21(13-15-27(26)30)17-29-20(3)24-11-7-9-22-8-5-6-10-25(22)24/h5-13,15-16,18,20,29H,4,14,17H2,1-3H3/b19-12+ |
| InChIKey | FBMSVTKJSTYRMV-XDHOZWIPSA-N |
| XLogP | 7.08 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.54 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |