C32H39F3N6O — CID 142834234
N-[3-[1-(2,4-difluorophenyl)-3-fluoropropan-2-yl]-4-oxoquinazolin-7-yl]-N'-[(1S,2S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]piperazine-1-carboximidamide (PubChem CID 142834234) has the molecular formula C32H39F3N6O and a molecular weight of 580.70 g/mol. Its IUPAC name is N-[3-[1-(2,4-difluorophenyl)-3-fluoropropan-2-yl]-4-oxoquinazolin-7-yl]-N'-[(1S,2S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]piperazine-1-carboximidamide.
| Compound Name | N-[3-[1-(2,4-difluorophenyl)-3-fluoropropan-2-yl]-4-oxoquinazolin-7-yl]-N'-[(1S,2S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 142834234 |
| Molecular Formula | C32H39F3N6O |
| Molecular Weight | 580.70 g/mol |
| Exact Mass | 580.31 |
| IUPAC Name | N-[3-[1-(2,4-difluorophenyl)-3-fluoropropan-2-yl]-4-oxoquinazolin-7-yl]-N'-[(1S,2S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]piperazine-1-carboximidamide |
| SMILES | C[C@@H]1C(/N=C(/Nc2ccc3c(=O)n(C(CF)Cc4ccc(F)cc4F)cnc3c2)N2CCNCC2)C[C@H]2C[C@@H]1C2(C)C |
| InChI | InChI=1S/C32H39F3N6O/c1-19-26-13-21(32(26,2)3)14-28(19)39-31(40-10-8-36-9-11-40)38-23-6-7-25-29(16-23)37-18-41(30(25)42)24(17-33)12-20-4-5-22(34)15-27(20)35/h4-7,15-16,18-19,21,24,26,28,36H,8-14,17H2,1-3H3,(H,38,39)/t19-,21+,24?,26-,28?/m0/s1 |
| InChIKey | BKLMWBSOESBNDU-SVCUOOJPSA-N |
| XLogP | 5.17 |
| TPSA | 74.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.70 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|