C9H11OP — CID 142835572
1-(3-methylphosphanylidenecyclohexa-1,4-dien-1-yl)ethanone (PubChem CID 142835572) has the molecular formula C9H11OP and a molecular weight of 166.16 g/mol. Its IUPAC name is 1-(3-methylphosphanylidenecyclohexa-1,4-dien-1-yl)ethanone.
| Compound Name | 1-(3-methylphosphanylidenecyclohexa-1,4-dien-1-yl)ethanone |
|---|---|
| PubChem CID | 142835572 |
| Molecular Formula | C9H11OP |
| Molecular Weight | 166.16 g/mol |
| Exact Mass | 166.05 |
| IUPAC Name | 1-(3-methylphosphanylidenecyclohexa-1,4-dien-1-yl)ethanone |
| SMILES | C/P=C1\C=CCC(C(C)=O)=C1 |
| InChI | InChI=1S/C9H11OP/c1-7(10)8-4-3-5-9(6-8)11-2/h3,5-6H,4H2,1-2H3 |
| InChIKey | VOYROEQIFOGJGZ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.16 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|