C7H7IO — CID 158914895
1-(3-iodocyclopenta-1,3-dien-1-yl)ethanone (PubChem CID 158914895) has the molecular formula C7H7IO and a molecular weight of 234.04 g/mol. Its IUPAC name is 1-(3-iodocyclopenta-1,3-dien-1-yl)ethanone.
| Compound Name | 1-(3-iodocyclopenta-1,3-dien-1-yl)ethanone |
|---|---|
| PubChem CID | 158914895 |
| Molecular Formula | C7H7IO |
| Molecular Weight | 234.04 g/mol |
| Exact Mass | 233.95 |
| IUPAC Name | 1-(3-iodocyclopenta-1,3-dien-1-yl)ethanone |
| SMILES | CC(=O)C1=CC(I)=CC1 |
| InChI | InChI=1S/C7H7IO/c1-5(9)6-2-3-7(8)4-6/h3-4H,2H2,1H3 |
| InChIKey | IVLXTUGAOFXSGO-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.04 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|