C16H31N3 — CID 142836680
(3E,5E)-5-N,5-N-bis(prop-2-enyl)octa-3,5-diene-2,4,5-triamine;ethane (PubChem CID 142836680) has the molecular formula C16H31N3 and a molecular weight of 265.44 g/mol. Its IUPAC name is (3E,5E)-5-N,5-N-bis(prop-2-enyl)octa-3,5-diene-2,4,5-triamine;ethane.
| Compound Name | (3E,5E)-5-N,5-N-bis(prop-2-enyl)octa-3,5-diene-2,4,5-triamine;ethane |
|---|---|
| PubChem CID | 142836680 |
| Molecular Formula | C16H31N3 |
| Molecular Weight | 265.44 g/mol |
| Exact Mass | 265.25 |
| IUPAC Name | (3E,5E)-5-N,5-N-bis(prop-2-enyl)octa-3,5-diene-2,4,5-triamine;ethane |
| SMILES | C=CCN(CC=C)C(=C/CC)/C(N)=C\C(C)N.CC |
| InChI | InChI=1S/C14H25N3.C2H6/c1-5-8-14(13(16)11-12(4)15)17(9-6-2)10-7-3;1-2/h6-8,11-12H,2-3,5,9-10,15-16H2,1,4H3;1-2H3/b13-11+,14-8+; |
| InChIKey | VSTKTQPQLMOWAD-RDKUEBEOSA-N |
| XLogP | 3.17 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.44 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|