C22H23Cl2F3N2O3 — CID 142837007
N-[(3,5-dichlorophenyl)methyl]formamide;N-[[4-(trifluoromethoxy)phenyl]methyl]cyclopentanecarboxamide (PubChem CID 142837007) has the molecular formula C22H23Cl2F3N2O3 and a molecular weight of 491.34 g/mol. Its IUPAC name is N-[(3,5-dichlorophenyl)methyl]formamide;N-[[4-(trifluoromethoxy)phenyl]methyl]cyclopentanecarboxamide.
| Compound Name | N-[(3,5-dichlorophenyl)methyl]formamide;N-[[4-(trifluoromethoxy)phenyl]methyl]cyclopentanecarboxamide |
|---|---|
| PubChem CID | 142837007 |
| Molecular Formula | C22H23Cl2F3N2O3 |
| Molecular Weight | 491.34 g/mol |
| Exact Mass | 490.10 |
| IUPAC Name | N-[(3,5-dichlorophenyl)methyl]formamide;N-[[4-(trifluoromethoxy)phenyl]methyl]cyclopentanecarboxamide |
| SMILES | O=C(NCc1ccc(OC(F)(F)F)cc1)C1CCCC1.O=CNCc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C14H16F3NO2.C8H7Cl2NO/c15-14(16,17)20-12-7-5-10(6-8-12)9-18-13(19)11-3-1-2-4-11;9-7-1-6(4-11-5-12)2-8(10)3-7/h5-8,11H,1-4,9H2,(H,18,19);1-3,5H,4H2,(H,11,12) |
| InChIKey | HXMOICUYADKKFL-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.34 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|