C25H44 — CID 142837463
(4Z,8Z)-2,2,3,3,7,7,11,11-octamethyl-6,10-dimethylidene-8-propyldodeca-4,8-diene (PubChem CID 142837463) has the molecular formula C25H44 and a molecular weight of 344.63 g/mol. Its IUPAC name is (4Z,8Z)-2,2,3,3,7,7,11,11-octamethyl-6,10-dimethylidene-8-propyldodeca-4,8-diene.
| Compound Name | (4Z,8Z)-2,2,3,3,7,7,11,11-octamethyl-6,10-dimethylidene-8-propyldodeca-4,8-diene |
|---|---|
| PubChem CID | 142837463 |
| Molecular Formula | C25H44 |
| Molecular Weight | 344.63 g/mol |
| Exact Mass | 344.34 |
| IUPAC Name | (4Z,8Z)-2,2,3,3,7,7,11,11-octamethyl-6,10-dimethylidene-8-propyldodeca-4,8-diene |
| SMILES | C=C(/C=C(/CCC)C(C)(C)C(=C)/C=C\C(C)(C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C25H44/c1-14-15-21(18-20(3)22(4,5)6)25(12,13)19(2)16-17-24(10,11)23(7,8)9/h16-18H,2-3,14-15H2,1,4-13H3/b17-16-,21-18- |
| InChIKey | VEXLRDKSHCYZEM-YJRRHQFJSA-N |
| XLogP | 8.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.63 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|