C11H16F3NO3 — CID 142839884
(3Z,4E,6E)-1-(methylamino)-3-(2,2,2-trifluoroethylidene)octa-4,6-diene-2,5,6-triol (PubChem CID 142839884) has the molecular formula C11H16F3NO3 and a molecular weight of 267.25 g/mol. Its IUPAC name is (3Z,4E,6E)-1-(methylamino)-3-(2,2,2-trifluoroethylidene)octa-4,6-diene-2,5,6-triol.
| Compound Name | (3Z,4E,6E)-1-(methylamino)-3-(2,2,2-trifluoroethylidene)octa-4,6-diene-2,5,6-triol |
|---|---|
| PubChem CID | 142839884 |
| Molecular Formula | C11H16F3NO3 |
| Molecular Weight | 267.25 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | (3Z,4E,6E)-1-(methylamino)-3-(2,2,2-trifluoroethylidene)octa-4,6-diene-2,5,6-triol |
| SMILES | C/C=C(O)\C(O)=C/C(=C/C(F)(F)F)C(O)CNC |
| InChI | InChI=1S/C11H16F3NO3/c1-3-8(16)9(17)4-7(5-11(12,13)14)10(18)6-15-2/h3-5,10,15-18H,6H2,1-2H3/b7-5-,8-3+,9-4+ |
| InChIKey | STWPJYBEUPWQGD-WCKFUKGTSA-N |
| XLogP | 1.96 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.25 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|