C11H21NO — CID 142920413
(Z,3E)-1-(methylamino)-3-propylidenehept-4-en-2-ol (PubChem CID 142920413) has the molecular formula C11H21NO and a molecular weight of 183.29 g/mol. Its IUPAC name is (Z,3E)-1-(methylamino)-3-propylidenehept-4-en-2-ol.
| Compound Name | (Z,3E)-1-(methylamino)-3-propylidenehept-4-en-2-ol |
|---|---|
| PubChem CID | 142920413 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | (Z,3E)-1-(methylamino)-3-propylidenehept-4-en-2-ol |
| SMILES | CC/C=C\C(=C/CC)C(O)CNC |
| InChI | InChI=1S/C11H21NO/c1-4-6-8-10(7-5-2)11(13)9-12-3/h6-8,11-13H,4-5,9H2,1-3H3/b8-6-,10-7+ |
| InChIKey | CQAIIATXBYHSNW-GOOBONSCSA-N |
| XLogP | 1.87 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|