C14H13NO3S — CID 142841547
7-methoxy-3-(2-methyl-2,3-dihydro-1,3-thiazol-4-yl)chromen-2-one (PubChem CID 142841547) has the molecular formula C14H13NO3S and a molecular weight of 275.33 g/mol. Its IUPAC name is 7-methoxy-3-(2-methyl-2,3-dihydro-1,3-thiazol-4-yl)chromen-2-one.
| Compound Name | 7-methoxy-3-(2-methyl-2,3-dihydro-1,3-thiazol-4-yl)chromen-2-one |
|---|---|
| PubChem CID | 142841547 |
| Molecular Formula | C14H13NO3S |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | 7-methoxy-3-(2-methyl-2,3-dihydro-1,3-thiazol-4-yl)chromen-2-one |
| SMILES | COc1ccc2cc(C3=CSC(C)N3)c(=O)oc2c1 |
| InChI | InChI=1S/C14H13NO3S/c1-8-15-12(7-19-8)11-5-9-3-4-10(17-2)6-13(9)18-14(11)16/h3-8,15H,1-2H3 |
| InChIKey | GKKXMHGXIMJZJO-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|