C20H22N4OS — CID 142843206
1-[4-(4-methylphenyl)piperazin-1-yl]-2-(3-thiophen-2-ylpyrazol-1-yl)ethanone (PubChem CID 142843206) has the molecular formula C20H22N4OS and a molecular weight of 366.49 g/mol. Its IUPAC name is 1-[4-(4-methylphenyl)piperazin-1-yl]-2-(3-thiophen-2-ylpyrazol-1-yl)ethanone.
| Compound Name | 1-[4-(4-methylphenyl)piperazin-1-yl]-2-(3-thiophen-2-ylpyrazol-1-yl)ethanone |
|---|---|
| PubChem CID | 142843206 |
| Molecular Formula | C20H22N4OS |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | 1-[4-(4-methylphenyl)piperazin-1-yl]-2-(3-thiophen-2-ylpyrazol-1-yl)ethanone |
| SMILES | Cc1ccc(N2CCN(C(=O)Cn3ccc(-c4cccs4)n3)CC2)cc1 |
| InChI | InChI=1S/C20H22N4OS/c1-16-4-6-17(7-5-16)22-10-12-23(13-11-22)20(25)15-24-9-8-18(21-24)19-3-2-14-26-19/h2-9,14H,10-13,15H2,1H3 |
| InChIKey | XFNVDGDXYGBLIR-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|