C22H23IN4O3S — CID 70829470
ethyl 1-[2-[4-(4-iodophenyl)piperazin-1-yl]-2-oxoethyl]-3-thiophen-2-ylpyrazole-5-carboxylate (PubChem CID 70829470) has the molecular formula C22H23IN4O3S and a molecular weight of 550.42 g/mol. Its IUPAC name is ethyl 1-[2-[4-(4-iodophenyl)piperazin-1-yl]-2-oxoethyl]-3-thiophen-2-ylpyrazole-5-carboxylate.
| Compound Name | ethyl 1-[2-[4-(4-iodophenyl)piperazin-1-yl]-2-oxoethyl]-3-thiophen-2-ylpyrazole-5-carboxylate |
|---|---|
| PubChem CID | 70829470 |
| Molecular Formula | C22H23IN4O3S |
| Molecular Weight | 550.42 g/mol |
| Exact Mass | 550.05 |
| IUPAC Name | ethyl 1-[2-[4-(4-iodophenyl)piperazin-1-yl]-2-oxoethyl]-3-thiophen-2-ylpyrazole-5-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2cccs2)nn1CC(=O)N1CCN(c2ccc(I)cc2)CC1 |
| InChI | InChI=1S/C22H23IN4O3S/c1-2-30-22(29)19-14-18(20-4-3-13-31-20)24-27(19)15-21(28)26-11-9-25(10-12-26)17-7-5-16(23)6-8-17/h3-8,13-14H,2,9-12,15H2,1H3 |
| InChIKey | JWTKTZKTUDEQDH-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 67.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.42 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|