C22H25N3O2S2 — CID 86873498
1-[4-(4-methylphenyl)-1,4-diazepan-1-yl]-2-[(5-thiophen-2-yl-1,2-oxazol-3-yl)methylsulfanyl]ethanone (PubChem CID 86873498) has the molecular formula C22H25N3O2S2 and a molecular weight of 427.60 g/mol. Its IUPAC name is 1-[4-(4-methylphenyl)-1,4-diazepan-1-yl]-2-[(5-thiophen-2-yl-1,2-oxazol-3-yl)methylsulfanyl]ethanone.
| Compound Name | 1-[4-(4-methylphenyl)-1,4-diazepan-1-yl]-2-[(5-thiophen-2-yl-1,2-oxazol-3-yl)methylsulfanyl]ethanone |
|---|---|
| PubChem CID | 86873498 |
| Molecular Formula | C22H25N3O2S2 |
| Molecular Weight | 427.60 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | 1-[4-(4-methylphenyl)-1,4-diazepan-1-yl]-2-[(5-thiophen-2-yl-1,2-oxazol-3-yl)methylsulfanyl]ethanone |
| SMILES | Cc1ccc(N2CCCN(C(=O)CSCc3cc(-c4cccs4)on3)CC2)cc1 |
| InChI | InChI=1S/C22H25N3O2S2/c1-17-5-7-19(8-6-17)24-9-3-10-25(12-11-24)22(26)16-28-15-18-14-20(27-23-18)21-4-2-13-29-21/h2,4-8,13-14H,3,9-12,15-16H2,1H3 |
| InChIKey | BXVBFRPBWAFYFU-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 49.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.60 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|