C24H43F — CID 142844577
1,4-dimethylcyclohexane;1,4-dimethylcyclohexene;2-fluoro-1,4-dimethylcyclohexene (PubChem CID 142844577) has the molecular formula C24H43F and a molecular weight of 350.61 g/mol. Its IUPAC name is 1,4-dimethylcyclohexane;1,4-dimethylcyclohexene;2-fluoro-1,4-dimethylcyclohexene.
| Compound Name | 1,4-dimethylcyclohexane;1,4-dimethylcyclohexene;2-fluoro-1,4-dimethylcyclohexene |
|---|---|
| PubChem CID | 142844577 |
| Molecular Formula | C24H43F |
| Molecular Weight | 350.61 g/mol |
| Exact Mass | 350.33 |
| IUPAC Name | 1,4-dimethylcyclohexane;1,4-dimethylcyclohexene;2-fluoro-1,4-dimethylcyclohexene |
| SMILES | CC1=C(F)CC(C)CC1.CC1=CCC(C)CC1.CC1CCC(C)CC1 |
| InChI | InChI=1S/C8H13F.C8H16.C8H14/c1-6-3-4-7(2)8(9)5-6;2*1-7-3-5-8(2)6-4-7/h6H,3-5H2,1-2H3;7-8H,3-6H2,1-2H3;3,8H,4-6H2,1-2H3 |
| InChIKey | AMGXNIBTPGQLIQ-UHFFFAOYSA-N |
| XLogP | 8.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.61 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|