C22H40 — CID 142844880
[(Z)-5-cyclohexyl-2,3-dimethyloct-3-enyl]cyclohexane (PubChem CID 142844880) has the molecular formula C22H40 and a molecular weight of 304.56 g/mol. Its IUPAC name is [(Z)-5-cyclohexyl-2,3-dimethyloct-3-enyl]cyclohexane.
| Compound Name | [(Z)-5-cyclohexyl-2,3-dimethyloct-3-enyl]cyclohexane |
|---|---|
| PubChem CID | 142844880 |
| Molecular Formula | C22H40 |
| Molecular Weight | 304.56 g/mol |
| Exact Mass | 304.31 |
| IUPAC Name | [(Z)-5-cyclohexyl-2,3-dimethyloct-3-enyl]cyclohexane |
| SMILES | CCCC(/C=C(/C)C(C)CC1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C22H40/c1-4-11-22(21-14-9-6-10-15-21)17-19(3)18(2)16-20-12-7-5-8-13-20/h17-18,20-22H,4-16H2,1-3H3/b19-17- |
| InChIKey | KKCNDSCNNXADDQ-ZPHPHTNESA-N |
| XLogP | 7.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.56 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|