C32H48N4O6 — CID 142846848
(2S,4E,6E)-2-acetamido-7-hydroxy-4-methyl-N-[(2S)-3-methyl-1-oxo-1-[[(2S)-1-oxo-1-[(2-oxo-7-phenylheptyl)amino]propan-2-yl]amino]butan-2-yl]octa-4,6-dienamide (PubChem CID 142846848) has the molecular formula C32H48N4O6 and a molecular weight of 584.76 g/mol. Its IUPAC name is (2S,4E,6E)-2-acetamido-7-hydroxy-4-methyl-N-[(2S)-3-methyl-1-oxo-1-[[(2S)-1-oxo-1-[(2-oxo-7-phenylheptyl)amino]propan-2-yl]amino]butan-2-yl]octa-4,6-dienamide.
| Compound Name | (2S,4E,6E)-2-acetamido-7-hydroxy-4-methyl-N-[(2S)-3-methyl-1-oxo-1-[[(2S)-1-oxo-1-[(2-oxo-7-phenylheptyl)amino]propan-2-yl]amino]butan-2-yl]octa-4,6-dienamide |
|---|---|
| PubChem CID | 142846848 |
| Molecular Formula | C32H48N4O6 |
| Molecular Weight | 584.76 g/mol |
| Exact Mass | 584.36 |
| IUPAC Name | (2S,4E,6E)-2-acetamido-7-hydroxy-4-methyl-N-[(2S)-3-methyl-1-oxo-1-[[(2S)-1-oxo-1-[(2-oxo-7-phenylheptyl)amino]propan-2-yl]amino]butan-2-yl]octa-4,6-dienamide |
| SMILES | CC(=O)N[C@@H](C/C(C)=C/C=C(\C)O)C(=O)N[C@H](C(=O)N[C@@H](C)C(=O)NCC(=O)CCCCCc1ccccc1)C(C)C |
| InChI | InChI=1S/C32H48N4O6/c1-21(2)29(36-31(41)28(35-25(6)38)19-22(3)17-18-23(4)37)32(42)34-24(5)30(40)33-20-27(39)16-12-8-11-15-26-13-9-7-10-14-26/h7,9-10,13-14,17-18,21,24,28-29,37H,8,11-12,15-16,19-20H2,1-6H3,(H,33,40)(H,34,42)(H,35,38)(H,36,41)/b22-17+,23-18+/t24-,28-,29-/m0/s1 |
| InChIKey | BCKLSARWRATWGY-FABOAEPTSA-N |
| XLogP | 3.42 |
| TPSA | 153.70 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.76 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|