C26H38ClN3O4 — CID 143189280
(5E,7E)-8-chloro-N-ethyl-2-hydroxy-5-methyl-3-[[(2S)-3-methyl-2-(3-phenylpropanoylamino)butanoyl]amino]nona-5,7-dienamide (PubChem CID 143189280) has the molecular formula C26H38ClN3O4 and a molecular weight of 492.06 g/mol. Its IUPAC name is (5E,7E)-8-chloro-N-ethyl-2-hydroxy-5-methyl-3-[[(2S)-3-methyl-2-(3-phenylpropanoylamino)butanoyl]amino]nona-5,7-dienamide.
| Compound Name | (5E,7E)-8-chloro-N-ethyl-2-hydroxy-5-methyl-3-[[(2S)-3-methyl-2-(3-phenylpropanoylamino)butanoyl]amino]nona-5,7-dienamide |
|---|---|
| PubChem CID | 143189280 |
| Molecular Formula | C26H38ClN3O4 |
| Molecular Weight | 492.06 g/mol |
| Exact Mass | 491.26 |
| IUPAC Name | (5E,7E)-8-chloro-N-ethyl-2-hydroxy-5-methyl-3-[[(2S)-3-methyl-2-(3-phenylpropanoylamino)butanoyl]amino]nona-5,7-dienamide |
| SMILES | CCNC(=O)C(O)C(C/C(C)=C/C=C(\C)Cl)NC(=O)[C@@H](NC(=O)CCc1ccccc1)C(C)C |
| InChI | InChI=1S/C26H38ClN3O4/c1-6-28-26(34)24(32)21(16-18(4)12-13-19(5)27)29-25(33)23(17(2)3)30-22(31)15-14-20-10-8-7-9-11-20/h7-13,17,21,23-24,32H,6,14-16H2,1-5H3,(H,28,34)(H,29,33)(H,30,31)/b18-12+,19-13+/t21?,23-,24?/m0/s1 |
| InChIKey | XFEBDNJKFCIKKB-LQTNJGGXSA-N |
| XLogP | 3.22 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.06 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|