C29H42N4O9 — CID 57117995
(3S)-3-[[(2S)-2-[[(4S)-4-acetamido-2-(aminomethyl)-5-carboxy-3-oxopentanoyl]amino]-3-methylbutanoyl]amino]-4-oxo-9-phenylnonanoic acid (PubChem CID 57117995) has the molecular formula C29H42N4O9 and a molecular weight of 590.67 g/mol. Its IUPAC name is (3S)-3-[[(2S)-2-[[(4S)-4-acetamido-2-(aminomethyl)-5-carboxy-3-oxopentanoyl]amino]-3-methylbutanoyl]amino]-4-oxo-9-phenylnonanoic acid.
| Compound Name | (3S)-3-[[(2S)-2-[[(4S)-4-acetamido-2-(aminomethyl)-5-carboxy-3-oxopentanoyl]amino]-3-methylbutanoyl]amino]-4-oxo-9-phenylnonanoic acid |
|---|---|
| PubChem CID | 57117995 |
| Molecular Formula | C29H42N4O9 |
| Molecular Weight | 590.67 g/mol |
| Exact Mass | 590.30 |
| IUPAC Name | (3S)-3-[[(2S)-2-[[(4S)-4-acetamido-2-(aminomethyl)-5-carboxy-3-oxopentanoyl]amino]-3-methylbutanoyl]amino]-4-oxo-9-phenylnonanoic acid |
| SMILES | CC(=O)N[C@@H](CC(=O)O)C(=O)C(CN)C(=O)N[C@H](C(=O)N[C@@H](CC(=O)O)C(=O)CCCCCc1ccccc1)C(C)C |
| InChI | InChI=1S/C29H42N4O9/c1-17(2)26(33-28(41)20(16-30)27(40)22(15-25(38)39)31-18(3)34)29(42)32-21(14-24(36)37)23(35)13-9-5-8-12-19-10-6-4-7-11-19/h4,6-7,10-11,17,20-22,26H,5,8-9,12-16,30H2,1-3H3,(H,31,34)(H,32,42)(H,33,41)(H,36,37)(H,38,39)/t20?,21-,22-,26-/m0/s1 |
| InChIKey | UYJIFRSEWUOVBM-FWLOSBONSA-N |
| XLogP | 0.58 |
| TPSA | 222.06 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.67 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|